C14H19BrFN3O — CID 61018400
2-[(5-bromo-2-fluorophenyl)methyl-methylamino]-1-piperazin-1-ylethanone (PubChem CID 61018400) has the molecular formula C14H19BrFN3O and a molecular weight of 344.23 g/mol. Its IUPAC name is 2-[(5-bromo-2-fluorophenyl)methyl-methylamino]-1-piperazin-1-ylethanone.
| Compound Name | 2-[(5-bromo-2-fluorophenyl)methyl-methylamino]-1-piperazin-1-ylethanone |
|---|---|
| PubChem CID | 61018400 |
| Molecular Formula | C14H19BrFN3O |
| Molecular Weight | 344.23 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | 2-[(5-bromo-2-fluorophenyl)methyl-methylamino]-1-piperazin-1-ylethanone |
| SMILES | CN(CC(=O)N1CCNCC1)Cc1cc(Br)ccc1F |
| InChI | InChI=1S/C14H19BrFN3O/c1-18(9-11-8-12(15)2-3-13(11)16)10-14(20)19-6-4-17-5-7-19/h2-3,8,17H,4-7,9-10H2,1H3 |
| InChIKey | YUGRLRKKJAFRPQ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.23 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |