C16H25ClFN3O — CID 120835994
2-[(2-ethyl-6-fluorophenyl)methyl-methylamino]-1-piperazin-1-ylethanone;hydrochloride (PubChem CID 120835994) has the molecular formula C16H25ClFN3O and a molecular weight of 329.85 g/mol. Its IUPAC name is 2-[(2-ethyl-6-fluorophenyl)methyl-methylamino]-1-piperazin-1-ylethanone;hydrochloride.
| Compound Name | 2-[(2-ethyl-6-fluorophenyl)methyl-methylamino]-1-piperazin-1-ylethanone;hydrochloride |
|---|---|
| PubChem CID | 120835994 |
| Molecular Formula | C16H25ClFN3O |
| Molecular Weight | 329.85 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 2-[(2-ethyl-6-fluorophenyl)methyl-methylamino]-1-piperazin-1-ylethanone;hydrochloride |
| SMILES | CCc1cccc(F)c1CN(C)CC(=O)N1CCNCC1.Cl |
| InChI | InChI=1S/C16H24FN3O.ClH/c1-3-13-5-4-6-15(17)14(13)11-19(2)12-16(21)20-9-7-18-8-10-20;/h4-6,18H,3,7-12H2,1-2H3;1H |
| InChIKey | SXSAFQARMWTGPP-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.85 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |