C12H15BrFN3O — CID 115171561
N-[(5-bromo-2-fluorophenyl)methyl]piperazine-1-carboxamide (PubChem CID 115171561) has the molecular formula C12H15BrFN3O and a molecular weight of 316.17 g/mol. Its IUPAC name is N-[(5-bromo-2-fluorophenyl)methyl]piperazine-1-carboxamide.
| Compound Name | N-[(5-bromo-2-fluorophenyl)methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 115171561 |
| Molecular Formula | C12H15BrFN3O |
| Molecular Weight | 316.17 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | N-[(5-bromo-2-fluorophenyl)methyl]piperazine-1-carboxamide |
| SMILES | O=C(NCc1cc(Br)ccc1F)N1CCNCC1 |
| InChI | InChI=1S/C12H15BrFN3O/c13-10-1-2-11(14)9(7-10)8-16-12(18)17-5-3-15-4-6-17/h1-2,7,15H,3-6,8H2,(H,16,18) |
| InChIKey | NJOLBMRDKBIDCF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.17 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |