C22H28FN3O4S — CID 55358521
4-fluoro-N-[4-[4-(4-methoxyphenyl)piperazin-1-yl]-4-oxobutyl]-N-methylbenzenesulfonamide (PubChem CID 55358521) has the molecular formula C22H28FN3O4S and a molecular weight of 449.55 g/mol. Its IUPAC name is 4-fluoro-N-[4-[4-(4-methoxyphenyl)piperazin-1-yl]-4-oxobutyl]-N-methylbenzenesulfonamide.
| Compound Name | 4-fluoro-N-[4-[4-(4-methoxyphenyl)piperazin-1-yl]-4-oxobutyl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 55358521 |
| Molecular Formula | C22H28FN3O4S |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | 4-fluoro-N-[4-[4-(4-methoxyphenyl)piperazin-1-yl]-4-oxobutyl]-N-methylbenzenesulfonamide |
| SMILES | COc1ccc(N2CCN(C(=O)CCCN(C)S(=O)(=O)c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H28FN3O4S/c1-24(31(28,29)21-11-5-18(23)6-12-21)13-3-4-22(27)26-16-14-25(15-17-26)19-7-9-20(30-2)10-8-19/h5-12H,3-4,13-17H2,1-2H3 |
| InChIKey | AWDLBGUVZAIWFY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|