C23H30N4O5S — CID 55918517
N-[4-[[2-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-2-oxoethyl]-methylsulfamoyl]phenyl]acetamide (PubChem CID 55918517) has the molecular formula C23H30N4O5S and a molecular weight of 474.58 g/mol. Its IUPAC name is N-[4-[[2-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-2-oxoethyl]-methylsulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[[2-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-2-oxoethyl]-methylsulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 55918517 |
| Molecular Formula | C23H30N4O5S |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | N-[4-[[2-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-2-oxoethyl]-methylsulfamoyl]phenyl]acetamide |
| SMILES | COc1ccc(N2CCCN(C(=O)CN(C)S(=O)(=O)c3ccc(NC(C)=O)cc3)CC2)cc1 |
| InChI | InChI=1S/C23H30N4O5S/c1-18(28)24-19-5-11-22(12-6-19)33(30,31)25(2)17-23(29)27-14-4-13-26(15-16-27)20-7-9-21(32-3)10-8-20/h5-12H,4,13-17H2,1-3H3,(H,24,28) |
| InChIKey | HDMBGGJMSFWDDE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|