C22H30N4O6S2 — CID 30266279
4-[[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-methylsulfonylamino]-N,N-dimethylbenzenesulfonamide (PubChem CID 30266279) has the molecular formula C22H30N4O6S2 and a molecular weight of 510.64 g/mol. Its IUPAC name is 4-[[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-methylsulfonylamino]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-[[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-methylsulfonylamino]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 30266279 |
| Molecular Formula | C22H30N4O6S2 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | 4-[[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-methylsulfonylamino]-N,N-dimethylbenzenesulfonamide |
| SMILES | COc1ccc(N2CCN(C(=O)CN(c3ccc(S(=O)(=O)N(C)C)cc3)S(C)(=O)=O)CC2)cc1 |
| InChI | InChI=1S/C22H30N4O6S2/c1-23(2)34(30,31)21-11-7-19(8-12-21)26(33(4,28)29)17-22(27)25-15-13-24(14-16-25)18-5-9-20(32-3)10-6-18/h5-12H,13-17H2,1-4H3 |
| InChIKey | UABLYJOTTAECII-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 107.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|