C20H23Cl2N3O4S — CID 1321606
N-(2,3-dichlorophenyl)-N-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]methanesulfonamide (PubChem CID 1321606) has the molecular formula C20H23Cl2N3O4S and a molecular weight of 472.39 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-N-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]methanesulfonamide.
| Compound Name | N-(2,3-dichlorophenyl)-N-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]methanesulfonamide |
|---|---|
| PubChem CID | 1321606 |
| Molecular Formula | C20H23Cl2N3O4S |
| Molecular Weight | 472.39 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | N-(2,3-dichlorophenyl)-N-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]methanesulfonamide |
| SMILES | COc1ccc(N2CCN(C(=O)CN(c3cccc(Cl)c3Cl)S(C)(=O)=O)CC2)cc1 |
| InChI | InChI=1S/C20H23Cl2N3O4S/c1-29-16-8-6-15(7-9-16)23-10-12-24(13-11-23)19(26)14-25(30(2,27)28)18-5-3-4-17(21)20(18)22/h3-9H,10-14H2,1-2H3 |
| InChIKey | LUVPZIRAUDQODR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|