C11H9F2NO4 — CID 702461
(E)-4-[4-(difluoromethoxy)anilino]-4-oxobut-2-enoic acid (PubChem CID 702461) has the molecular formula C11H9F2NO4 and a molecular weight of 257.19 g/mol. Its IUPAC name is (E)-4-[4-(difluoromethoxy)anilino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[4-(difluoromethoxy)anilino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 702461 |
| Molecular Formula | C11H9F2NO4 |
| Molecular Weight | 257.19 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | (E)-4-[4-(difluoromethoxy)anilino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C11H9F2NO4/c12-11(13)18-8-3-1-7(2-4-8)14-9(15)5-6-10(16)17/h1-6,11H,(H,14,15)(H,16,17)/b6-5+ |
| InChIKey | WCVNEIQZAAIBBX-AATRIKPKSA-N |
| XLogP | 1.87 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.19 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|