C13H11NO4 — CID 174335661
(Z)-4-oxo-4-(4-prop-2-ynoxyanilino)but-2-enoic acid (PubChem CID 174335661) has the molecular formula C13H11NO4 and a molecular weight of 245.23 g/mol. Its IUPAC name is (Z)-4-oxo-4-(4-prop-2-ynoxyanilino)but-2-enoic acid.
| Compound Name | (Z)-4-oxo-4-(4-prop-2-ynoxyanilino)but-2-enoic acid |
|---|---|
| PubChem CID | 174335661 |
| Molecular Formula | C13H11NO4 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | (Z)-4-oxo-4-(4-prop-2-ynoxyanilino)but-2-enoic acid |
| SMILES | C#CCOc1ccc(NC(=O)/C=C\C(=O)O)cc1 |
| InChI | InChI=1S/C13H11NO4/c1-2-9-18-11-5-3-10(4-6-11)14-12(15)7-8-13(16)17/h1,3-8H,9H2,(H,14,15)(H,16,17)/b8-7- |
| InChIKey | KZEBLCBKPBCBNS-FPLPWBNLSA-N |
| XLogP | 1.28 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|