C12H9ClF3NO4 — CID 46861363
(E)-4-[4-(2-chloro-1,1,2-trifluoroethoxy)anilino]-4-oxobut-2-enoic acid (PubChem CID 46861363) has the molecular formula C12H9ClF3NO4 and a molecular weight of 323.65 g/mol. Its IUPAC name is (E)-4-[4-(2-chloro-1,1,2-trifluoroethoxy)anilino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[4-(2-chloro-1,1,2-trifluoroethoxy)anilino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 46861363 |
| Molecular Formula | C12H9ClF3NO4 |
| Molecular Weight | 323.65 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | (E)-4-[4-(2-chloro-1,1,2-trifluoroethoxy)anilino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)Nc1ccc(OC(F)(F)C(F)Cl)cc1 |
| InChI | InChI=1S/C12H9ClF3NO4/c13-11(14)12(15,16)21-8-3-1-7(2-4-8)17-9(18)5-6-10(19)20/h1-6,11H,(H,17,18)(H,19,20)/b6-5+ |
| InChIKey | GYQQNDDALGSLMJ-AATRIKPKSA-N |
| XLogP | 2.77 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.65 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|