C24H27N3O4 — CID 58467560
6-[[2-[(2R)-4-(3,4-dihydro-2H-chromen-6-yl)-2-methylpiperazin-1-yl]-2-oxoethyl]amino]-3H-1-benzofuran-2-one (PubChem CID 58467560) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is 6-[[2-[(2R)-4-(3,4-dihydro-2H-chromen-6-yl)-2-methylpiperazin-1-yl]-2-oxoethyl]amino]-3H-1-benzofuran-2-one.
| Compound Name | 6-[[2-[(2R)-4-(3,4-dihydro-2H-chromen-6-yl)-2-methylpiperazin-1-yl]-2-oxoethyl]amino]-3H-1-benzofuran-2-one |
|---|---|
| PubChem CID | 58467560 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 6-[[2-[(2R)-4-(3,4-dihydro-2H-chromen-6-yl)-2-methylpiperazin-1-yl]-2-oxoethyl]amino]-3H-1-benzofuran-2-one |
| SMILES | C[C@@H]1CN(c2ccc3c(c2)CCCO3)CCN1C(=O)CNc1ccc2c(c1)OC(=O)C2 |
| InChI | InChI=1S/C24H27N3O4/c1-16-15-26(20-6-7-21-17(11-20)3-2-10-30-21)8-9-27(16)23(28)14-25-19-5-4-18-12-24(29)31-22(18)13-19/h4-7,11,13,16,25H,2-3,8-10,12,14-15H2,1H3/t16-/m1/s1 |
| InChIKey | XELVPTIZAYBAGX-MRXNPFEDSA-N |
| XLogP | 2.62 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|