C24H25F2N3O3 — CID 58467448
6-[[2-[(2R)-4-(3,5-difluoro-4-methoxyphenyl)-2-methylpiperazin-1-yl]-2-oxoethyl]amino]-1H-naphthalen-2-one (PubChem CID 58467448) has the molecular formula C24H25F2N3O3 and a molecular weight of 441.48 g/mol. Its IUPAC name is 6-[[2-[(2R)-4-(3,5-difluoro-4-methoxyphenyl)-2-methylpiperazin-1-yl]-2-oxoethyl]amino]-1H-naphthalen-2-one.
| Compound Name | 6-[[2-[(2R)-4-(3,5-difluoro-4-methoxyphenyl)-2-methylpiperazin-1-yl]-2-oxoethyl]amino]-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 58467448 |
| Molecular Formula | C24H25F2N3O3 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 6-[[2-[(2R)-4-(3,5-difluoro-4-methoxyphenyl)-2-methylpiperazin-1-yl]-2-oxoethyl]amino]-1H-naphthalen-2-one |
| SMILES | COc1c(F)cc(N2CCN(C(=O)CNc3ccc4c(c3)C=CC(=O)C4)[C@H](C)C2)cc1F |
| InChI | InChI=1S/C24H25F2N3O3/c1-15-14-28(19-11-21(25)24(32-2)22(26)12-19)7-8-29(15)23(31)13-27-18-5-3-17-10-20(30)6-4-16(17)9-18/h3-6,9,11-12,15,27H,7-8,10,13-14H2,1-2H3/t15-/m1/s1 |
| InChIKey | CWSXFZYECKACCK-OAHLLOKOSA-N |
| XLogP | 3.26 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|