C22H23ClF2N4O2 — CID 58467631
6-[[2-[(2R)-4-(4-chloro-3,5-difluorophenyl)-2-methylpiperazin-1-yl]-2-oxoethyl]amino]-1-methyl-3H-indol-2-one (PubChem CID 58467631) has the molecular formula C22H23ClF2N4O2 and a molecular weight of 448.90 g/mol. Its IUPAC name is 6-[[2-[(2R)-4-(4-chloro-3,5-difluorophenyl)-2-methylpiperazin-1-yl]-2-oxoethyl]amino]-1-methyl-3H-indol-2-one.
| Compound Name | 6-[[2-[(2R)-4-(4-chloro-3,5-difluorophenyl)-2-methylpiperazin-1-yl]-2-oxoethyl]amino]-1-methyl-3H-indol-2-one |
|---|---|
| PubChem CID | 58467631 |
| Molecular Formula | C22H23ClF2N4O2 |
| Molecular Weight | 448.90 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 6-[[2-[(2R)-4-(4-chloro-3,5-difluorophenyl)-2-methylpiperazin-1-yl]-2-oxoethyl]amino]-1-methyl-3H-indol-2-one |
| SMILES | C[C@@H]1CN(c2cc(F)c(Cl)c(F)c2)CCN1C(=O)CNc1ccc2c(c1)N(C)C(=O)C2 |
| InChI | InChI=1S/C22H23ClF2N4O2/c1-13-12-28(16-9-17(24)22(23)18(25)10-16)5-6-29(13)21(31)11-26-15-4-3-14-7-20(30)27(2)19(14)8-15/h3-4,8-10,13,26H,5-7,11-12H2,1-2H3/t13-/m1/s1 |
| InChIKey | JBIIVBKVRBPIIY-CYBMUJFWSA-N |
| XLogP | 3.29 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.90 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|