C25H32F3N5O — CID 129105411
(2R)-N-[2-(4-benzylpiperazin-1-yl)ethyl]-2-methyl-4-(3,4,5-trifluorophenyl)piperazine-1-carboxamide (PubChem CID 129105411) has the molecular formula C25H32F3N5O and a molecular weight of 475.56 g/mol. Its IUPAC name is (2R)-N-[2-(4-benzylpiperazin-1-yl)ethyl]-2-methyl-4-(3,4,5-trifluorophenyl)piperazine-1-carboxamide.
| Compound Name | (2R)-N-[2-(4-benzylpiperazin-1-yl)ethyl]-2-methyl-4-(3,4,5-trifluorophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 129105411 |
| Molecular Formula | C25H32F3N5O |
| Molecular Weight | 475.56 g/mol |
| Exact Mass | 475.26 |
| IUPAC Name | (2R)-N-[2-(4-benzylpiperazin-1-yl)ethyl]-2-methyl-4-(3,4,5-trifluorophenyl)piperazine-1-carboxamide |
| SMILES | C[C@@H]1CN(c2cc(F)c(F)c(F)c2)CCN1C(=O)NCCN1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C25H32F3N5O/c1-19-17-32(21-15-22(26)24(28)23(27)16-21)13-14-33(19)25(34)29-7-8-30-9-11-31(12-10-30)18-20-5-3-2-4-6-20/h2-6,15-16,19H,7-14,17-18H2,1H3,(H,29,34)/t19-/m1/s1 |
| InChIKey | VFTBODIKGPFXMS-LJQANCHMSA-N |
| XLogP | 3.14 |
| TPSA | 42.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.56 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|