C24H31F3N4OS — CID 129105403
(2R)-2-methyl-N-[2-[1-(thiophen-2-ylmethyl)piperidin-4-yl]ethyl]-4-(3,4,5-trifluorophenyl)piperazine-1-carboxamide (PubChem CID 129105403) has the molecular formula C24H31F3N4OS and a molecular weight of 480.60 g/mol. Its IUPAC name is (2R)-2-methyl-N-[2-[1-(thiophen-2-ylmethyl)piperidin-4-yl]ethyl]-4-(3,4,5-trifluorophenyl)piperazine-1-carboxamide.
| Compound Name | (2R)-2-methyl-N-[2-[1-(thiophen-2-ylmethyl)piperidin-4-yl]ethyl]-4-(3,4,5-trifluorophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 129105403 |
| Molecular Formula | C24H31F3N4OS |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | (2R)-2-methyl-N-[2-[1-(thiophen-2-ylmethyl)piperidin-4-yl]ethyl]-4-(3,4,5-trifluorophenyl)piperazine-1-carboxamide |
| SMILES | C[C@@H]1CN(c2cc(F)c(F)c(F)c2)CCN1C(=O)NCCC1CCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C24H31F3N4OS/c1-17-15-30(19-13-21(25)23(27)22(26)14-19)10-11-31(17)24(32)28-7-4-18-5-8-29(9-6-18)16-20-3-2-12-33-20/h2-3,12-14,17-18H,4-11,15-16H2,1H3,(H,28,32)/t17-/m1/s1 |
| InChIKey | VJPSKBYMCHVXKK-QGZVFWFLSA-N |
| XLogP | 4.69 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|