C26H33F3N4O — CID 129105353
(2R)-N-[2-(1-benzylpiperidin-4-yl)ethyl]-2-methyl-4-(2,4,5-trifluorophenyl)piperazine-1-carboxamide (PubChem CID 129105353) has the molecular formula C26H33F3N4O and a molecular weight of 474.57 g/mol. Its IUPAC name is (2R)-N-[2-(1-benzylpiperidin-4-yl)ethyl]-2-methyl-4-(2,4,5-trifluorophenyl)piperazine-1-carboxamide.
| Compound Name | (2R)-N-[2-(1-benzylpiperidin-4-yl)ethyl]-2-methyl-4-(2,4,5-trifluorophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 129105353 |
| Molecular Formula | C26H33F3N4O |
| Molecular Weight | 474.57 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | (2R)-N-[2-(1-benzylpiperidin-4-yl)ethyl]-2-methyl-4-(2,4,5-trifluorophenyl)piperazine-1-carboxamide |
| SMILES | C[C@@H]1CN(c2cc(F)c(F)cc2F)CCN1C(=O)NCCC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C26H33F3N4O/c1-19-17-32(25-16-23(28)22(27)15-24(25)29)13-14-33(19)26(34)30-10-7-20-8-11-31(12-9-20)18-21-5-3-2-4-6-21/h2-6,15-16,19-20H,7-14,17-18H2,1H3,(H,30,34)/t19-/m1/s1 |
| InChIKey | IXZFLBNPEJPPNX-LJQANCHMSA-N |
| XLogP | 4.63 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.57 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|