C22H23ClN4O3 — CID 58467530
2-[(2R)-4-(4-chlorophenyl)-2-methylpiperazin-1-yl]-N-(1-methyl-2-oxo-3H-indol-6-yl)-2-oxoacetamide (PubChem CID 58467530) has the molecular formula C22H23ClN4O3 and a molecular weight of 426.90 g/mol. Its IUPAC name is 2-[(2R)-4-(4-chlorophenyl)-2-methylpiperazin-1-yl]-N-(1-methyl-2-oxo-3H-indol-6-yl)-2-oxoacetamide.
| Compound Name | 2-[(2R)-4-(4-chlorophenyl)-2-methylpiperazin-1-yl]-N-(1-methyl-2-oxo-3H-indol-6-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 58467530 |
| Molecular Formula | C22H23ClN4O3 |
| Molecular Weight | 426.90 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | 2-[(2R)-4-(4-chlorophenyl)-2-methylpiperazin-1-yl]-N-(1-methyl-2-oxo-3H-indol-6-yl)-2-oxoacetamide |
| SMILES | C[C@@H]1CN(c2ccc(Cl)cc2)CCN1C(=O)C(=O)Nc1ccc2c(c1)N(C)C(=O)C2 |
| InChI | InChI=1S/C22H23ClN4O3/c1-14-13-26(18-7-4-16(23)5-8-18)9-10-27(14)22(30)21(29)24-17-6-3-15-11-20(28)25(2)19(15)12-17/h3-8,12,14H,9-11,13H2,1-2H3,(H,24,29)/t14-/m1/s1 |
| InChIKey | OBUVMWGXBFXFJF-CQSZACIVSA-N |
| XLogP | 2.53 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.90 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|