C15H21N3O2 — CID 43145090
2-(1,4-diazepan-1-yl)-2-oxo-N-(2-phenylethyl)acetamide (PubChem CID 43145090) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-2-oxo-N-(2-phenylethyl)acetamide.
| Compound Name | 2-(1,4-diazepan-1-yl)-2-oxo-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 43145090 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-2-oxo-N-(2-phenylethyl)acetamide |
| SMILES | O=C(NCCc1ccccc1)C(=O)N1CCCNCC1 |
| InChI | InChI=1S/C15H21N3O2/c19-14(15(20)18-11-4-8-16-10-12-18)17-9-7-13-5-2-1-3-6-13/h1-3,5-6,16H,4,7-12H2,(H,17,19) |
| InChIKey | ABSHSEJKGSBAPB-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|