C9H15F2N3O2 — CID 115408222
2-(1,4-diazepan-1-yl)-N-(2,2-difluoroethyl)-2-oxoacetamide (PubChem CID 115408222) has the molecular formula C9H15F2N3O2 and a molecular weight of 235.23 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-N-(2,2-difluoroethyl)-2-oxoacetamide.
| Compound Name | 2-(1,4-diazepan-1-yl)-N-(2,2-difluoroethyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 115408222 |
| Molecular Formula | C9H15F2N3O2 |
| Molecular Weight | 235.23 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-N-(2,2-difluoroethyl)-2-oxoacetamide |
| SMILES | O=C(NCC(F)F)C(=O)N1CCCNCC1 |
| InChI | InChI=1S/C9H15F2N3O2/c10-7(11)6-13-8(15)9(16)14-4-1-2-12-3-5-14/h7,12H,1-6H2,(H,13,15) |
| InChIKey | WKRFLSHKPLJFGD-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.23 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|