C12H23N3O2S — CID 113479277
2-(1,4-diazepan-1-yl)-N-(2-methyl-2-methylsulfanylpropyl)-2-oxoacetamide (PubChem CID 113479277) has the molecular formula C12H23N3O2S and a molecular weight of 273.40 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-N-(2-methyl-2-methylsulfanylpropyl)-2-oxoacetamide.
| Compound Name | 2-(1,4-diazepan-1-yl)-N-(2-methyl-2-methylsulfanylpropyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 113479277 |
| Molecular Formula | C12H23N3O2S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-N-(2-methyl-2-methylsulfanylpropyl)-2-oxoacetamide |
| SMILES | CSC(C)(C)CNC(=O)C(=O)N1CCCNCC1 |
| InChI | InChI=1S/C12H23N3O2S/c1-12(2,18-3)9-14-10(16)11(17)15-7-4-5-13-6-8-15/h13H,4-9H2,1-3H3,(H,14,16) |
| InChIKey | HAOCYMLSZFLDJL-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|