C13H26N2O — CID 119418751
1-(1,4-diazepan-1-yl)-5,5-dimethylhexan-1-one (PubChem CID 119418751) has the molecular formula C13H26N2O and a molecular weight of 226.36 g/mol. Its IUPAC name is 1-(1,4-diazepan-1-yl)-5,5-dimethylhexan-1-one.
| Compound Name | 1-(1,4-diazepan-1-yl)-5,5-dimethylhexan-1-one |
|---|---|
| PubChem CID | 119418751 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | 1-(1,4-diazepan-1-yl)-5,5-dimethylhexan-1-one |
| SMILES | CC(C)(C)CCCC(=O)N1CCCNCC1 |
| InChI | InChI=1S/C13H26N2O/c1-13(2,3)7-4-6-12(16)15-10-5-8-14-9-11-15/h14H,4-11H2,1-3H3 |
| InChIKey | PUBCVLUOLJQTGU-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |