About 5-amino-1-(1,4-diazepan-1-yl)hexan-1-one
5-amino-1-(1,4-diazepan-1-yl)hexan-1-one (PubChem CID 82848388) has the molecular formula C11H23N3O
and a molecular weight of 213.32 g/mol. Its IUPAC name is 5-amino-1-(1,4-diazepan-1-yl)hexan-1-one.
Molecular Properties
| Compound Name | 5-amino-1-(1,4-diazepan-1-yl)hexan-1-one |
| PubChem CID | 82848388 |
| Molecular Formula | C11H23N3O |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | 5-amino-1-(1,4-diazepan-1-yl)hexan-1-one |
| SMILES | CC(N)CCCC(=O)N1CCCNCC1 |
| InChI | InChI=1S/C11H23N3O/c1-10(12)4-2-5-11(15)14-8-3-6-13-7-9-14/h10,13H,2-9,12H2,1H3 |
| InChIKey | HRCLCEYKTARKFU-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-amino-1-(1,4-diazepan-1-yl)hexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-1-(1,4-diazepan-1-yl)hexan-1-one?
The IUPAC name of 5-amino-1-(1,4-diazepan-1-yl)hexan-1-one (CID 82848388) is 5-amino-1-(1,4-diazepan-1-yl)hexan-1-one.
What is the SMILES notation for 5-amino-1-(1,4-diazepan-1-yl)hexan-1-one?
The canonical SMILES for 5-amino-1-(1,4-diazepan-1-yl)hexan-1-one is CC(N)CCCC(=O)N1CCCNCC1.
What is the InChIKey of 5-amino-1-(1,4-diazepan-1-yl)hexan-1-one?
The InChIKey is HRCLCEYKTARKFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N3O/c1-10(12)4-2-5-11(15)14-8-3-6-13-7-9-14/h10,13H,2-9,12H2,1H3.
What are the key properties of 5-amino-1-(1,4-diazepan-1-yl)hexan-1-one?
5-amino-1-(1,4-diazepan-1-yl)hexan-1-one has a molecular weight of 213.32 g/mol, XLogP of 0.33, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-1-(1,4-diazepan-1-yl)hexan-1-one is sourced from PubChem (CID 82848388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).