C14H28N2O — CID 93256894
(3R)-1-(1,4-diazepan-1-yl)-3,5,5-trimethylhexan-1-one (PubChem CID 93256894) has the molecular formula C14H28N2O and a molecular weight of 240.39 g/mol. Its IUPAC name is (3R)-1-(1,4-diazepan-1-yl)-3,5,5-trimethylhexan-1-one.
| Compound Name | (3R)-1-(1,4-diazepan-1-yl)-3,5,5-trimethylhexan-1-one |
|---|---|
| PubChem CID | 93256894 |
| Molecular Formula | C14H28N2O |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.22 |
| IUPAC Name | (3R)-1-(1,4-diazepan-1-yl)-3,5,5-trimethylhexan-1-one |
| SMILES | C[C@@H](CC(=O)N1CCCNCC1)CC(C)(C)C |
| InChI | InChI=1S/C14H28N2O/c1-12(11-14(2,3)4)10-13(17)16-8-5-6-15-7-9-16/h12,15H,5-11H2,1-4H3/t12-/m0/s1 |
| InChIKey | GEAOAXXILQQRHM-LBPRGKRZSA-N |
| XLogP | 2.27 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |