C13H26N2O — CID 93256892
(3R)-3,5,5-trimethyl-1-piperazin-1-ylhexan-1-one (PubChem CID 93256892) has the molecular formula C13H26N2O and a molecular weight of 226.36 g/mol. Its IUPAC name is (3R)-3,5,5-trimethyl-1-piperazin-1-ylhexan-1-one.
| Compound Name | (3R)-3,5,5-trimethyl-1-piperazin-1-ylhexan-1-one |
|---|---|
| PubChem CID | 93256892 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | (3R)-3,5,5-trimethyl-1-piperazin-1-ylhexan-1-one |
| SMILES | C[C@@H](CC(=O)N1CCNCC1)CC(C)(C)C |
| InChI | InChI=1S/C13H26N2O/c1-11(10-13(2,3)4)9-12(16)15-7-5-14-6-8-15/h11,14H,5-10H2,1-4H3/t11-/m0/s1 |
| InChIKey | YMNUGOCPVHQQNK-NSHDSACASA-N |
| XLogP | 1.88 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |