C15H30N2O — CID 79507159
1-(3,3-dimethylpiperazin-1-yl)-3,5,5-trimethylhexan-1-one (PubChem CID 79507159) has the molecular formula C15H30N2O and a molecular weight of 254.42 g/mol. Its IUPAC name is 1-(3,3-dimethylpiperazin-1-yl)-3,5,5-trimethylhexan-1-one.
| Compound Name | 1-(3,3-dimethylpiperazin-1-yl)-3,5,5-trimethylhexan-1-one |
|---|---|
| PubChem CID | 79507159 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | 1-(3,3-dimethylpiperazin-1-yl)-3,5,5-trimethylhexan-1-one |
| SMILES | CC(CC(=O)N1CCNC(C)(C)C1)CC(C)(C)C |
| InChI | InChI=1S/C15H30N2O/c1-12(10-14(2,3)4)9-13(18)17-8-7-16-15(5,6)11-17/h12,16H,7-11H2,1-6H3 |
| InChIKey | FSBNJTOVNOTYCV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |