C8H13Cl3N2O — CID 82245855
2,2,2-trichloro-1-(3,3-dimethylpiperazin-1-yl)ethanone (PubChem CID 82245855) has the molecular formula C8H13Cl3N2O and a molecular weight of 259.56 g/mol. Its IUPAC name is 2,2,2-trichloro-1-(3,3-dimethylpiperazin-1-yl)ethanone.
| Compound Name | 2,2,2-trichloro-1-(3,3-dimethylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 82245855 |
| Molecular Formula | C8H13Cl3N2O |
| Molecular Weight | 259.56 g/mol |
| Exact Mass | 258.01 |
| IUPAC Name | 2,2,2-trichloro-1-(3,3-dimethylpiperazin-1-yl)ethanone |
| SMILES | CC1(C)CN(C(=O)C(Cl)(Cl)Cl)CCN1 |
| InChI | InChI=1S/C8H13Cl3N2O/c1-7(2)5-13(4-3-12-7)6(14)8(9,10)11/h12H,3-5H2,1-2H3 |
| InChIKey | ZUYLFTUEPNJAEM-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.56 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|