C9H18N2O2 — CID 130635624
(2S)-1-(3,3-dimethylpiperazin-1-yl)-2-hydroxypropan-1-one (PubChem CID 130635624) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is (2S)-1-(3,3-dimethylpiperazin-1-yl)-2-hydroxypropan-1-one.
| Compound Name | (2S)-1-(3,3-dimethylpiperazin-1-yl)-2-hydroxypropan-1-one |
|---|---|
| PubChem CID | 130635624 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | (2S)-1-(3,3-dimethylpiperazin-1-yl)-2-hydroxypropan-1-one |
| SMILES | C[C@H](O)C(=O)N1CCNC(C)(C)C1 |
| InChI | InChI=1S/C9H18N2O2/c1-7(12)8(13)11-5-4-10-9(2,3)6-11/h7,10,12H,4-6H2,1-3H3/t7-/m0/s1 |
| InChIKey | OFTDJLCZABBZKB-ZETCQYMHSA-N |
| XLogP | -0.42 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |