4-ethyl-1-(3,5,5-trimethylhexanoyl)piperidine-4-carboxylic acid

C17H31NO3 — CID 63125277

IUPAC4-ethyl-1-(3,5,5-trimethylhexanoyl)piperidine-4-carboxylic acid
SMILESCCC1(C(=O)O)CCN(C(=O)CC(C)CC(C)(C)C)CC1
InChIInChI=1S/C17H31NO3/c1-6-17(15(20)21)7-9-18(10-8-17)14(19)11-13(2)12-16(3,4)5/h13H,6-12H2,1-5H3,(H,20,21)
InChIKeyQEZGTNABHIHZJS-UHFFFAOYSA-N
MW297.44 g/mol
LogP3.55
Rot. Bonds5

About 4-ethyl-1-(3,5,5-trimethylhexanoyl)piperidine-4-carboxylic acid

4-ethyl-1-(3,5,5-trimethylhexanoyl)piperidine-4-carboxylic acid (PubChem CID 63125277) has the molecular formula C17H31NO3 and a molecular weight of 297.44 g/mol. Its IUPAC name is 4-ethyl-1-(3,5,5-trimethylhexanoyl)piperidine-4-carboxylic acid.

Molecular Properties

Compound Name4-ethyl-1-(3,5,5-trimethylhexanoyl)piperidine-4-carboxylic acid
PubChem CID63125277
Molecular FormulaC17H31NO3
Molecular Weight297.44 g/mol
Exact Mass297.23
IUPAC Name4-ethyl-1-(3,5,5-trimethylhexanoyl)piperidine-4-carboxylic acid
SMILESCCC1(C(=O)O)CCN(C(=O)CC(C)CC(C)(C)C)CC1
InChIInChI=1S/C17H31NO3/c1-6-17(15(20)21)7-9-18(10-8-17)14(19)11-13(2)12-16(3,4)5/h13H,6-12H2,1-5H3,(H,20,21)
InChIKeyQEZGTNABHIHZJS-UHFFFAOYSA-N
XLogP3.55
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500297.44
LogP ≤ 53.55
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 4-ethyl-1-(3,5,5-trimethylhexanoyl)piperidine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-ethyl-1-(3,5,5-trimethylhexanoyl)piperidine-4-carboxylic acid?
The IUPAC name of 4-ethyl-1-(3,5,5-trimethylhexanoyl)piperidine-4-carboxylic acid (CID 63125277) is 4-ethyl-1-(3,5,5-trimethylhexanoyl)piperidine-4-carboxylic acid.
What is the SMILES notation for 4-ethyl-1-(3,5,5-trimethylhexanoyl)piperidine-4-carboxylic acid?
The canonical SMILES for 4-ethyl-1-(3,5,5-trimethylhexanoyl)piperidine-4-carboxylic acid is CCC1(C(=O)O)CCN(C(=O)CC(C)CC(C)(C)C)CC1.
What is the InChIKey of 4-ethyl-1-(3,5,5-trimethylhexanoyl)piperidine-4-carboxylic acid?
The InChIKey is QEZGTNABHIHZJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H31NO3/c1-6-17(15(20)21)7-9-18(10-8-17)14(19)11-13(2)12-16(3,4)5/h13H,6-12H2,1-5H3,(H,20,21).
What are the key properties of 4-ethyl-1-(3,5,5-trimethylhexanoyl)piperidine-4-carboxylic acid?
4-ethyl-1-(3,5,5-trimethylhexanoyl)piperidine-4-carboxylic acid has a molecular weight of 297.44 g/mol, XLogP of 3.55, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-1-(3,5,5-trimethylhexanoyl)piperidine-4-carboxylic acid is sourced from PubChem (CID 63125277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).