C15H27N3O — CID 63337260
2-[4-(3,5,5-trimethylhexanoyl)piperazin-1-yl]acetonitrile (PubChem CID 63337260) has the molecular formula C15H27N3O and a molecular weight of 265.40 g/mol. Its IUPAC name is 2-[4-(3,5,5-trimethylhexanoyl)piperazin-1-yl]acetonitrile.
| Compound Name | 2-[4-(3,5,5-trimethylhexanoyl)piperazin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 63337260 |
| Molecular Formula | C15H27N3O |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.22 |
| IUPAC Name | 2-[4-(3,5,5-trimethylhexanoyl)piperazin-1-yl]acetonitrile |
| SMILES | CC(CC(=O)N1CCN(CC#N)CC1)CC(C)(C)C |
| InChI | InChI=1S/C15H27N3O/c1-13(12-15(2,3)4)11-14(19)18-9-7-17(6-5-16)8-10-18/h13H,6-12H2,1-4H3 |
| InChIKey | HTYTYGAUCCOUSM-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|