C12H21N3O — CID 63336804
2-[4-(2,2-dimethylbutanoyl)piperazin-1-yl]acetonitrile (PubChem CID 63336804) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is 2-[4-(2,2-dimethylbutanoyl)piperazin-1-yl]acetonitrile.
| Compound Name | 2-[4-(2,2-dimethylbutanoyl)piperazin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 63336804 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 2-[4-(2,2-dimethylbutanoyl)piperazin-1-yl]acetonitrile |
| SMILES | CCC(C)(C)C(=O)N1CCN(CC#N)CC1 |
| InChI | InChI=1S/C12H21N3O/c1-4-12(2,3)11(16)15-9-7-14(6-5-13)8-10-15/h4,6-10H2,1-3H3 |
| InChIKey | USGYGEDMLBSQED-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|