C11H22N2O3S — CID 118669191
2,2-dimethyl-1-(4-methylsulfonylpiperazin-1-yl)butan-1-one (PubChem CID 118669191) has the molecular formula C11H22N2O3S and a molecular weight of 262.37 g/mol. Its IUPAC name is 2,2-dimethyl-1-(4-methylsulfonylpiperazin-1-yl)butan-1-one.
| Compound Name | 2,2-dimethyl-1-(4-methylsulfonylpiperazin-1-yl)butan-1-one |
|---|---|
| PubChem CID | 118669191 |
| Molecular Formula | C11H22N2O3S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 2,2-dimethyl-1-(4-methylsulfonylpiperazin-1-yl)butan-1-one |
| SMILES | CCC(C)(C)C(=O)N1CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C11H22N2O3S/c1-5-11(2,3)10(14)12-6-8-13(9-7-12)17(4,15)16/h5-9H2,1-4H3 |
| InChIKey | JHOJRUPOJKZLFR-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |