C15H27N3O3 — CID 63832479
N-(2-cyclohexyloxyethyl)-2-(1,4-diazepan-1-yl)-2-oxoacetamide (PubChem CID 63832479) has the molecular formula C15H27N3O3 and a molecular weight of 297.40 g/mol. Its IUPAC name is N-(2-cyclohexyloxyethyl)-2-(1,4-diazepan-1-yl)-2-oxoacetamide.
| Compound Name | N-(2-cyclohexyloxyethyl)-2-(1,4-diazepan-1-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 63832479 |
| Molecular Formula | C15H27N3O3 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | N-(2-cyclohexyloxyethyl)-2-(1,4-diazepan-1-yl)-2-oxoacetamide |
| SMILES | O=C(NCCOC1CCCCC1)C(=O)N1CCCNCC1 |
| InChI | InChI=1S/C15H27N3O3/c19-14(15(20)18-10-4-7-16-8-11-18)17-9-12-21-13-5-2-1-3-6-13/h13,16H,1-12H2,(H,17,19) |
| InChIKey | CUOLFPWFISXKAM-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|