C18H28N2O — CID 119414461
1-(1,4-diazepan-1-yl)-2,2-dimethyl-5-phenylpentan-1-one (PubChem CID 119414461) has the molecular formula C18H28N2O and a molecular weight of 288.43 g/mol. Its IUPAC name is 1-(1,4-diazepan-1-yl)-2,2-dimethyl-5-phenylpentan-1-one.
| Compound Name | 1-(1,4-diazepan-1-yl)-2,2-dimethyl-5-phenylpentan-1-one |
|---|---|
| PubChem CID | 119414461 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | 1-(1,4-diazepan-1-yl)-2,2-dimethyl-5-phenylpentan-1-one |
| SMILES | CC(C)(CCCc1ccccc1)C(=O)N1CCCNCC1 |
| InChI | InChI=1S/C18H28N2O/c1-18(2,11-6-10-16-8-4-3-5-9-16)17(21)20-14-7-12-19-13-15-20/h3-5,8-9,19H,6-7,10-15H2,1-2H3 |
| InChIKey | ZKUKEEWRUNICPB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |