C27H32N2O2 — CID 25175472
1-(3,3-diphenylpropyl)-3-(3-methoxyphenyl)-1-(2-methylpropyl)urea (PubChem CID 25175472) has the molecular formula C27H32N2O2 and a molecular weight of 416.57 g/mol. Its IUPAC name is 1-(3,3-diphenylpropyl)-3-(3-methoxyphenyl)-1-(2-methylpropyl)urea.
| Compound Name | 1-(3,3-diphenylpropyl)-3-(3-methoxyphenyl)-1-(2-methylpropyl)urea |
|---|---|
| PubChem CID | 25175472 |
| Molecular Formula | C27H32N2O2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | 1-(3,3-diphenylpropyl)-3-(3-methoxyphenyl)-1-(2-methylpropyl)urea |
| SMILES | COc1cccc(NC(=O)N(CCC(c2ccccc2)c2ccccc2)CC(C)C)c1 |
| InChI | InChI=1S/C27H32N2O2/c1-21(2)20-29(27(30)28-24-15-10-16-25(19-24)31-3)18-17-26(22-11-6-4-7-12-22)23-13-8-5-9-14-23/h4-16,19,21,26H,17-18,20H2,1-3H3,(H,28,30) |
| InChIKey | AZIFEQTWSIFKJM-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |