C27H29F3N2O — CID 69028477
1-(3,3-diphenylpropyl)-1-(2-methylpropyl)-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 69028477) has the molecular formula C27H29F3N2O and a molecular weight of 454.54 g/mol. Its IUPAC name is 1-(3,3-diphenylpropyl)-1-(2-methylpropyl)-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(3,3-diphenylpropyl)-1-(2-methylpropyl)-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 69028477 |
| Molecular Formula | C27H29F3N2O |
| Molecular Weight | 454.54 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | 1-(3,3-diphenylpropyl)-1-(2-methylpropyl)-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | CC(C)CN(CCC(c1ccccc1)c1ccccc1)C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H29F3N2O/c1-20(2)19-32(26(33)31-24-15-13-23(14-16-24)27(28,29)30)18-17-25(21-9-5-3-6-10-21)22-11-7-4-8-12-22/h3-16,20,25H,17-19H2,1-2H3,(H,31,33) |
| InChIKey | MDOMXEHCXNSOIT-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.54 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |