C18H26N4O3 — CID 8904009
2-(4-acetylpiperazin-1-yl)-N-methyl-N-[2-(4-methylanilino)-2-oxoethyl]acetamide (PubChem CID 8904009) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is 2-(4-acetylpiperazin-1-yl)-N-methyl-N-[2-(4-methylanilino)-2-oxoethyl]acetamide.
| Compound Name | 2-(4-acetylpiperazin-1-yl)-N-methyl-N-[2-(4-methylanilino)-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 8904009 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 2-(4-acetylpiperazin-1-yl)-N-methyl-N-[2-(4-methylanilino)-2-oxoethyl]acetamide |
| SMILES | CC(=O)N1CCN(CC(=O)N(C)CC(=O)Nc2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C18H26N4O3/c1-14-4-6-16(7-5-14)19-17(24)12-20(3)18(25)13-21-8-10-22(11-9-21)15(2)23/h4-7H,8-13H2,1-3H3,(H,19,24) |
| InChIKey | LOEGDUUFGNPUOY-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |