C17H24N4O3 — CID 8904118
4-[[2-(4-acetylpiperazin-1-yl)acetyl]amino]-N,N-dimethylbenzamide (PubChem CID 8904118) has the molecular formula C17H24N4O3 and a molecular weight of 332.40 g/mol. Its IUPAC name is 4-[[2-(4-acetylpiperazin-1-yl)acetyl]amino]-N,N-dimethylbenzamide.
| Compound Name | 4-[[2-(4-acetylpiperazin-1-yl)acetyl]amino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 8904118 |
| Molecular Formula | C17H24N4O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 4-[[2-(4-acetylpiperazin-1-yl)acetyl]amino]-N,N-dimethylbenzamide |
| SMILES | CC(=O)N1CCN(CC(=O)Nc2ccc(C(=O)N(C)C)cc2)CC1 |
| InChI | InChI=1S/C17H24N4O3/c1-13(22)21-10-8-20(9-11-21)12-16(23)18-15-6-4-14(5-7-15)17(24)19(2)3/h4-7H,8-12H2,1-3H3,(H,18,23) |
| InChIKey | YVUJLSZOXJEIOA-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |