About 1-methyl-4-[(E,2R)-4-phenylbut-3-en-2-yl]benzene
1-methyl-4-[(E,2R)-4-phenylbut-3-en-2-yl]benzene (PubChem CID 102584248) has the molecular formula C17H18
and a molecular weight of 222.33 g/mol. Its IUPAC name is 1-methyl-4-[(E,2R)-4-phenylbut-3-en-2-yl]benzene.
Molecular Properties
| Compound Name | 1-methyl-4-[(E,2R)-4-phenylbut-3-en-2-yl]benzene |
| PubChem CID | 102584248 |
| Molecular Formula | C17H18 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 1-methyl-4-[(E,2R)-4-phenylbut-3-en-2-yl]benzene |
| SMILES | Cc1ccc([C@H](C)/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C17H18/c1-14-8-12-17(13-9-14)15(2)10-11-16-6-4-3-5-7-16/h3-13,15H,1-2H3/b11-10+/t15-/m1/s1 |
| InChIKey | UQHGLBGARZZSBF-AUECHBEKSA-N |
| XLogP | 4.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-methyl-4-[(E,2R)-4-phenylbut-3-en-2-yl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-[(E,2R)-4-phenylbut-3-en-2-yl]benzene?
The IUPAC name of 1-methyl-4-[(E,2R)-4-phenylbut-3-en-2-yl]benzene (CID 102584248) is 1-methyl-4-[(E,2R)-4-phenylbut-3-en-2-yl]benzene.
What is the SMILES notation for 1-methyl-4-[(E,2R)-4-phenylbut-3-en-2-yl]benzene?
The canonical SMILES for 1-methyl-4-[(E,2R)-4-phenylbut-3-en-2-yl]benzene is Cc1ccc([C@H](C)/C=C/c2ccccc2)cc1.
What is the InChIKey of 1-methyl-4-[(E,2R)-4-phenylbut-3-en-2-yl]benzene?
The InChIKey is UQHGLBGARZZSBF-AUECHBEKSA-N. The full InChI is InChI=1S/C17H18/c1-14-8-12-17(13-9-14)15(2)10-11-16-6-4-3-5-7-16/h3-13,15H,1-2H3/b11-10+/t15-/m1/s1.
What are the key properties of 1-methyl-4-[(E,2R)-4-phenylbut-3-en-2-yl]benzene?
1-methyl-4-[(E,2R)-4-phenylbut-3-en-2-yl]benzene has a molecular weight of 222.33 g/mol, XLogP of 4.81, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-[(E,2R)-4-phenylbut-3-en-2-yl]benzene is sourced from PubChem (CID 102584248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).