C17H18 — CID 102584248
1-methyl-4-[(E,2R)-4-phenylbut-3-en-2-yl]benzene (PubChem CID 102584248) has the molecular formula C17H18 and a molecular weight of 222.33 g/mol. Its IUPAC name is 1-methyl-4-[(E,2R)-4-phenylbut-3-en-2-yl]benzene.
| Compound Name | 1-methyl-4-[(E,2R)-4-phenylbut-3-en-2-yl]benzene |
|---|---|
| PubChem CID | 102584248 |
| Molecular Formula | C17H18 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 1-methyl-4-[(E,2R)-4-phenylbut-3-en-2-yl]benzene |
| SMILES | Cc1ccc([C@H](C)/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C17H18/c1-14-8-12-17(13-9-14)15(2)10-11-16-6-4-3-5-7-16/h3-13,15H,1-2H3/b11-10+/t15-/m1/s1 |
| InChIKey | UQHGLBGARZZSBF-AUECHBEKSA-N |
| XLogP | 4.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |