About 1-[(E,3S)-3-phenylbut-1-enyl]-4-propan-2-ylbenzene
1-[(E,3S)-3-phenylbut-1-enyl]-4-propan-2-ylbenzene (PubChem CID 11288169) has the molecular formula C19H22
and a molecular weight of 250.39 g/mol. Its IUPAC name is 1-[(E,3S)-3-phenylbut-1-enyl]-4-propan-2-ylbenzene.
Molecular Properties
| Compound Name | 1-[(E,3S)-3-phenylbut-1-enyl]-4-propan-2-ylbenzene |
| PubChem CID | 11288169 |
| Molecular Formula | C19H22 |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 1-[(E,3S)-3-phenylbut-1-enyl]-4-propan-2-ylbenzene |
| SMILES | CC(C)c1ccc(/C=C/[C@H](C)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H22/c1-15(2)18-13-11-17(12-14-18)10-9-16(3)19-7-5-4-6-8-19/h4-16H,1-3H3/b10-9+/t16-/m0/s1 |
| InChIKey | GZAFDMRTONKIPN-SCOAYWHSSA-N |
| XLogP | 5.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-[(E,3S)-3-phenylbut-1-enyl]-4-propan-2-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E,3S)-3-phenylbut-1-enyl]-4-propan-2-ylbenzene?
The IUPAC name of 1-[(E,3S)-3-phenylbut-1-enyl]-4-propan-2-ylbenzene (CID 11288169) is 1-[(E,3S)-3-phenylbut-1-enyl]-4-propan-2-ylbenzene.
What is the SMILES notation for 1-[(E,3S)-3-phenylbut-1-enyl]-4-propan-2-ylbenzene?
The canonical SMILES for 1-[(E,3S)-3-phenylbut-1-enyl]-4-propan-2-ylbenzene is CC(C)c1ccc(/C=C/[C@H](C)c2ccccc2)cc1.
What is the InChIKey of 1-[(E,3S)-3-phenylbut-1-enyl]-4-propan-2-ylbenzene?
The InChIKey is GZAFDMRTONKIPN-SCOAYWHSSA-N. The full InChI is InChI=1S/C19H22/c1-15(2)18-13-11-17(12-14-18)10-9-16(3)19-7-5-4-6-8-19/h4-16H,1-3H3/b10-9+/t16-/m0/s1.
What are the key properties of 1-[(E,3S)-3-phenylbut-1-enyl]-4-propan-2-ylbenzene?
1-[(E,3S)-3-phenylbut-1-enyl]-4-propan-2-ylbenzene has a molecular weight of 250.39 g/mol, XLogP of 5.63, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E,3S)-3-phenylbut-1-enyl]-4-propan-2-ylbenzene is sourced from PubChem (CID 11288169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).