C16H15F — CID 177383855
1-fluoro-4-[(E,3R)-3-phenylbut-1-enyl]benzene (PubChem CID 177383855) has the molecular formula C16H15F and a molecular weight of 226.29 g/mol. Its IUPAC name is 1-fluoro-4-[(E,3R)-3-phenylbut-1-enyl]benzene.
| Compound Name | 1-fluoro-4-[(E,3R)-3-phenylbut-1-enyl]benzene |
|---|---|
| PubChem CID | 177383855 |
| Molecular Formula | C16H15F |
| Molecular Weight | 226.29 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 1-fluoro-4-[(E,3R)-3-phenylbut-1-enyl]benzene |
| SMILES | C[C@H](/C=C/c1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C16H15F/c1-13(15-5-3-2-4-6-15)7-8-14-9-11-16(17)12-10-14/h2-13H,1H3/b8-7+/t13-/m1/s1 |
| InChIKey | WANHMODXIZRMOV-SBDDDAINSA-N |
| XLogP | 4.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.29 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |