C17H17FN2O — CID 177394133
N'-[(E,1R)-3-(4-fluorophenyl)-1-phenylprop-2-enyl]acetohydrazide (PubChem CID 177394133) has the molecular formula C17H17FN2O and a molecular weight of 284.33 g/mol. Its IUPAC name is N'-[(E,1R)-3-(4-fluorophenyl)-1-phenylprop-2-enyl]acetohydrazide.
| Compound Name | N'-[(E,1R)-3-(4-fluorophenyl)-1-phenylprop-2-enyl]acetohydrazide |
|---|---|
| PubChem CID | 177394133 |
| Molecular Formula | C17H17FN2O |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | N'-[(E,1R)-3-(4-fluorophenyl)-1-phenylprop-2-enyl]acetohydrazide |
| SMILES | CC(=O)NN[C@H](/C=C/c1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C17H17FN2O/c1-13(21)19-20-17(15-5-3-2-4-6-15)12-9-14-7-10-16(18)11-8-14/h2-12,17,20H,1H3,(H,19,21)/b12-9+/t17-/m1/s1 |
| InChIKey | BOSXIWXCZAGANW-XLNAKTSKSA-N |
| XLogP | 3.22 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|