C17H15FO2 — CID 141413659
5-[(E)-4-(4-fluorophenyl)but-3-en-2-yl]-1,3-benzodioxole (PubChem CID 141413659) has the molecular formula C17H15FO2 and a molecular weight of 270.30 g/mol. Its IUPAC name is 5-[(E)-4-(4-fluorophenyl)but-3-en-2-yl]-1,3-benzodioxole.
| Compound Name | 5-[(E)-4-(4-fluorophenyl)but-3-en-2-yl]-1,3-benzodioxole |
|---|---|
| PubChem CID | 141413659 |
| Molecular Formula | C17H15FO2 |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 5-[(E)-4-(4-fluorophenyl)but-3-en-2-yl]-1,3-benzodioxole |
| SMILES | CC(/C=C/c1ccc(F)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H15FO2/c1-12(2-3-13-4-7-15(18)8-5-13)14-6-9-16-17(10-14)20-11-19-16/h2-10,12H,11H2,1H3/b3-2+ |
| InChIKey | DHUYTCKKHMYWGV-NSCUHMNNSA-N |
| XLogP | 4.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |