C17H25NO — CID 139373069
(E,4R,6R)-2,4,6-trimethyl-N-phenyloct-2-enamide (PubChem CID 139373069) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is (E,4R,6R)-2,4,6-trimethyl-N-phenyloct-2-enamide.
| Compound Name | (E,4R,6R)-2,4,6-trimethyl-N-phenyloct-2-enamide |
|---|---|
| PubChem CID | 139373069 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | (E,4R,6R)-2,4,6-trimethyl-N-phenyloct-2-enamide |
| SMILES | CC[C@@H](C)C[C@@H](C)/C=C(\C)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C17H25NO/c1-5-13(2)11-14(3)12-15(4)17(19)18-16-9-7-6-8-10-16/h6-10,12-14H,5,11H2,1-4H3,(H,18,19)/b15-12+/t13-,14-/m1/s1 |
| InChIKey | BBYHPABDZGKKQN-JZMJITHDSA-N |
| XLogP | 4.64 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|