C17H24N2O3 — CID 15545961
tert-butyl N-[(E,2S)-5-anilino-4-methyl-5-oxopent-3-en-2-yl]carbamate (PubChem CID 15545961) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is tert-butyl N-[(E,2S)-5-anilino-4-methyl-5-oxopent-3-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(E,2S)-5-anilino-4-methyl-5-oxopent-3-en-2-yl]carbamate |
|---|---|
| PubChem CID | 15545961 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | tert-butyl N-[(E,2S)-5-anilino-4-methyl-5-oxopent-3-en-2-yl]carbamate |
| SMILES | C/C(=C\[C@H](C)NC(=O)OC(C)(C)C)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C17H24N2O3/c1-12(15(20)19-14-9-7-6-8-10-14)11-13(2)18-16(21)22-17(3,4)5/h6-11,13H,1-5H3,(H,18,21)(H,19,20)/b12-11+/t13-/m0/s1 |
| InChIKey | LFZPEAODTCUSTM-YLSINNKHSA-N |
| XLogP | 3.48 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|