C12H14N2O2 — CID 69341649
(E)-N',2-dimethyl-N-phenylbut-2-enediamide (PubChem CID 69341649) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is (E)-N',2-dimethyl-N-phenylbut-2-enediamide.
| Compound Name | (E)-N',2-dimethyl-N-phenylbut-2-enediamide |
|---|---|
| PubChem CID | 69341649 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | (E)-N',2-dimethyl-N-phenylbut-2-enediamide |
| SMILES | CNC(=O)/C=C(\C)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C12H14N2O2/c1-9(8-11(15)13-2)12(16)14-10-6-4-3-5-7-10/h3-8H,1-2H3,(H,13,15)(H,14,16)/b9-8+ |
| InChIKey | WOGUKLBRSPNTBY-CMDGGOBGSA-N |
| XLogP | 1.32 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|