About (Z)-3-(methylamino)-N,3-diphenylprop-2-enamide
(Z)-3-(methylamino)-N,3-diphenylprop-2-enamide (PubChem CID 25157764) has the molecular formula C16H16N2O
and a molecular weight of 252.32 g/mol. Its IUPAC name is (Z)-3-(methylamino)-N,3-diphenylprop-2-enamide.
Molecular Properties
| Compound Name | (Z)-3-(methylamino)-N,3-diphenylprop-2-enamide |
| PubChem CID | 25157764 |
| Molecular Formula | C16H16N2O |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | (Z)-3-(methylamino)-N,3-diphenylprop-2-enamide |
| SMILES | CN/C(=C\C(=O)Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H16N2O/c1-17-15(13-8-4-2-5-9-13)12-16(19)18-14-10-6-3-7-11-14/h2-12,17H,1H3,(H,18,19)/b15-12- |
| InChIKey | XCRMFLKRXRDVPH-QINSGFPZSA-N |
| XLogP | 2.89 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-(methylamino)-N,3-diphenylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-(methylamino)-N,3-diphenylprop-2-enamide?
The IUPAC name of (Z)-3-(methylamino)-N,3-diphenylprop-2-enamide (CID 25157764) is (Z)-3-(methylamino)-N,3-diphenylprop-2-enamide.
What is the SMILES notation for (Z)-3-(methylamino)-N,3-diphenylprop-2-enamide?
The canonical SMILES for (Z)-3-(methylamino)-N,3-diphenylprop-2-enamide is CN/C(=C\C(=O)Nc1ccccc1)c1ccccc1.
What is the InChIKey of (Z)-3-(methylamino)-N,3-diphenylprop-2-enamide?
The InChIKey is XCRMFLKRXRDVPH-QINSGFPZSA-N. The full InChI is InChI=1S/C16H16N2O/c1-17-15(13-8-4-2-5-9-13)12-16(19)18-14-10-6-3-7-11-14/h2-12,17H,1H3,(H,18,19)/b15-12-.
What are the key properties of (Z)-3-(methylamino)-N,3-diphenylprop-2-enamide?
(Z)-3-(methylamino)-N,3-diphenylprop-2-enamide has a molecular weight of 252.32 g/mol, XLogP of 2.89, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-(methylamino)-N,3-diphenylprop-2-enamide is sourced from PubChem (CID 25157764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).