C29H23NO — CID 162340783
(2E,4Z)-5-anilino-1,3,5-triphenylpenta-2,4-dien-1-one (PubChem CID 162340783) has the molecular formula C29H23NO and a molecular weight of 401.51 g/mol. Its IUPAC name is (2E,4Z)-5-anilino-1,3,5-triphenylpenta-2,4-dien-1-one.
| Compound Name | (2E,4Z)-5-anilino-1,3,5-triphenylpenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 162340783 |
| Molecular Formula | C29H23NO |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | (2E,4Z)-5-anilino-1,3,5-triphenylpenta-2,4-dien-1-one |
| SMILES | O=C(/C=C(\C=C(/Nc1ccccc1)c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H23NO/c31-29(25-17-9-3-10-18-25)22-26(23-13-5-1-6-14-23)21-28(24-15-7-2-8-16-24)30-27-19-11-4-12-20-27/h1-22,30H/b26-22+,28-21- |
| InChIKey | ZBAJSMRTJQTESK-OSJAGNGRSA-N |
| XLogP | 7.11 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|