(E)-3-anilinobut-2-enoic acid

C10H11NO2 — CID 89350388

IUPAC(E)-3-anilinobut-2-enoic acid
SMILESC/C(=C\C(=O)O)Nc1ccccc1
InChIInChI=1S/C10H11NO2/c1-8(7-10(12)13)11-9-5-3-2-4-6-9/h2-7,11H,1H3,(H,12,13)/b8-7+
InChIKeyQYZQSBJGWXGMGN-BQYQJAHWSA-N
MW177.20 g/mol
LogP2.09
Rot. Bonds3

About (E)-3-anilinobut-2-enoic acid

(E)-3-anilinobut-2-enoic acid (PubChem CID 89350388) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is (E)-3-anilinobut-2-enoic acid.

Molecular Properties

Compound Name(E)-3-anilinobut-2-enoic acid
PubChem CID89350388
Molecular FormulaC10H11NO2
Molecular Weight177.20 g/mol
Exact Mass177.08
IUPAC Name(E)-3-anilinobut-2-enoic acid
SMILESC/C(=C\C(=O)O)Nc1ccccc1
InChIInChI=1S/C10H11NO2/c1-8(7-10(12)13)11-9-5-3-2-4-6-9/h2-7,11H,1H3,(H,12,13)/b8-7+
InChIKeyQYZQSBJGWXGMGN-BQYQJAHWSA-N
XLogP2.09
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500177.20
LogP ≤ 52.09
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E)-3-anilinobut-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-3-anilinobut-2-enoic acid?
The IUPAC name of (E)-3-anilinobut-2-enoic acid (CID 89350388) is (E)-3-anilinobut-2-enoic acid.
What is the SMILES notation for (E)-3-anilinobut-2-enoic acid?
The canonical SMILES for (E)-3-anilinobut-2-enoic acid is C/C(=C\C(=O)O)Nc1ccccc1.
What is the InChIKey of (E)-3-anilinobut-2-enoic acid?
The InChIKey is QYZQSBJGWXGMGN-BQYQJAHWSA-N. The full InChI is InChI=1S/C10H11NO2/c1-8(7-10(12)13)11-9-5-3-2-4-6-9/h2-7,11H,1H3,(H,12,13)/b8-7+.
What are the key properties of (E)-3-anilinobut-2-enoic acid?
(E)-3-anilinobut-2-enoic acid has a molecular weight of 177.20 g/mol, XLogP of 2.09, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-anilinobut-2-enoic acid is sourced from PubChem (CID 89350388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).