C35H38N2O6 — CID 161471976
bis(3-anilinobut-2-enoic acid);4-[2-(4-hydroxyphenyl)propan-2-yl]phenol (PubChem CID 161471976) has the molecular formula C35H38N2O6 and a molecular weight of 582.70 g/mol. Its IUPAC name is bis(3-anilinobut-2-enoic acid);4-[2-(4-hydroxyphenyl)propan-2-yl]phenol.
| Compound Name | bis(3-anilinobut-2-enoic acid);4-[2-(4-hydroxyphenyl)propan-2-yl]phenol |
|---|---|
| PubChem CID | 161471976 |
| Molecular Formula | C35H38N2O6 |
| Molecular Weight | 582.70 g/mol |
| Exact Mass | 582.27 |
| IUPAC Name | bis(3-anilinobut-2-enoic acid);4-[2-(4-hydroxyphenyl)propan-2-yl]phenol |
| SMILES | CC(=CC(=O)O)Nc1ccccc1.CC(=CC(=O)O)Nc1ccccc1.CC(C)(c1ccc(O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C15H16O2.2C10H11NO2/c1-15(2,11-3-7-13(16)8-4-11)12-5-9-14(17)10-6-12;2*1-8(7-10(12)13)11-9-5-3-2-4-6-9/h3-10,16-17H,1-2H3;2*2-7,11H,1H3,(H,12,13) |
| InChIKey | WDFCLRCFIXOZIP-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 139.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.70 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|