C15H18N2O2 — CID 142926888
(2E,4Z)-4-amino-5-methoxy-2-methyl-N-phenylhepta-2,4,6-trienamide (PubChem CID 142926888) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is (2E,4Z)-4-amino-5-methoxy-2-methyl-N-phenylhepta-2,4,6-trienamide.
| Compound Name | (2E,4Z)-4-amino-5-methoxy-2-methyl-N-phenylhepta-2,4,6-trienamide |
|---|---|
| PubChem CID | 142926888 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | (2E,4Z)-4-amino-5-methoxy-2-methyl-N-phenylhepta-2,4,6-trienamide |
| SMILES | C=C/C(OC)=C(N)\C=C(/C)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C15H18N2O2/c1-4-14(19-3)13(16)10-11(2)15(18)17-12-8-6-5-7-9-12/h4-10H,1,16H2,2-3H3,(H,17,18)/b11-10+,14-13- |
| InChIKey | JWWDMELJMFCQNM-SVEAWWMOSA-N |
| XLogP | 2.57 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|